ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25584-83-2 hydroxypropyl acrylate, mixture of isomers |
|
اسم المنتج | hydroxypropyl acrylate, mixture of isomers |
الاسم بالانجليزية | hydroxypropyl acrylate, mixture of isomers;Hydroxypropyl acrylate,mixture of isomers;Acrylic acid hydroxypropyl ester;BISOMER HPA;2-hydroxypropyl prop-2-enoate;1-hydroxypropan-2-yl prop-2-enoate;1-hydroxypropyl prop-2-enoate;Hydroxypropyl acrylate |
الصيغة الجزيئية | C6H10O3 |
الوزن الجزيئي الغرامي | 130.1418 |
InChI | InChI=1/C6H10O3/c1-3-5(7)9-6(8)4-2/h3,6,8H,1,4H2,2H3 |
إستراتيجية المساعدة القطرية | 25584-83-2 |
المفوضية الأوروبية رقم | 247-118-0 |
بنية جزيئية | |
كثافة | 1.049g/cm3 |
نقطة الغليان | 175.4°C at 760 mmHg |
معامل الإنكسار | 1.442 |
نقطة الوميض | 64.3°C |
ضغط البخار | 0.355mmHg at 25°C |
علامات على البضائع الخطرة | T##Toxic:; |
خطر المصطلحات | R23/24/25||R34||R43:; |
شروط الأمن | S26||S36/37/39||S45:; |
MSDS |