ChemIndex - A free chemical CAS databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1679-98-7 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole |
|
Ürün Adı | 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole |
ingilizce adı | 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole;2,5-Bis(4-diethylaminophenyl)-1,3,4-oxadiazole;2,5-bis(diethylamino)phenyl-1,3,4-oxadiazole;4,4'-(1,3,4-oxadiazole-2,5-diyl)bis(N,N-diethylaniline) |
Moleküler Formülü | C22H28N4O |
Molekül Ağırlığı | 364.4839 |
InChI | InChI=1/C22H28N4O/c1-5-25(6-2)19-13-9-17(10-14-19)21-23-24-22(27-21)18-11-15-20(16-12-18)26(7-3)8-4/h9-16H,5-8H2,1-4H3 |
CAS kayıt numarası | 1679-98-7 |
EINECS | 216-851-8 |
Moleküler Yapısı | |
Yoğunluk | 1.1g/cm3 |
Kaynama noktası | 526.4°C at 760 mmHg |
Kırılma indisi | 1.585 |
Alevlenme noktası | 272.2°C |
Buhar basıncı | 3.59E-11mmHg at 25°C |
Güvenlik Açıklaması | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |