ChemIndex - A free chemical CAS databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1679-98-7 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole |
|
نام محصول | 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole |
نام انگلیسی | 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole;2,5-Bis(4-diethylaminophenyl)-1,3,4-oxadiazole;2,5-bis(diethylamino)phenyl-1,3,4-oxadiazole;4,4'-(1,3,4-oxadiazole-2,5-diyl)bis(N,N-diethylaniline) |
میدان مغناطیسی | C22H28N4O |
وزن مولکولی | 364.4839 |
InChI | InChI=1/C22H28N4O/c1-5-25(6-2)19-13-9-17(10-14-19)21-23-24-22(27-21)18-11-15-20(16-12-18)26(7-3)8-4/h9-16H,5-8H2,1-4H3 |
شماره سیایاس | 1679-98-7 |
تعداد کمیسیون اروپایی | 216-851-8 |
ساختار مولکولی | |
تراکم | 1.1g/cm3 |
نقطه غلیان | 526.4°C at 760 mmHg |
ضریب شکست | 1.585 |
نقطه اشتعال | 272.2°C |
فشار بخار | 3.59E-11mmHg at 25°C |
توضیحات ایمنی | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |