ChemIndex - A free chemical CAS databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1679-98-7 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole |
|
उत्पाद का नाम | 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole |
अंग्रेज | 2,5-Bis(4'-diethylaminophenyl)-1,3,4-oxadiazole;2,5-Bis(4-diethylaminophenyl)-1,3,4-oxadiazole;2,5-bis(diethylamino)phenyl-1,3,4-oxadiazole;4,4'-(1,3,4-oxadiazole-2,5-diyl)bis(N,N-diethylaniline) |
आणविक फार्मूला | C22H28N4O |
आण्विक वजन | 364.4839 |
InChI | InChI=1/C22H28N4O/c1-5-25(6-2)19-13-9-17(10-14-19)21-23-24-22(27-21)18-11-15-20(16-12-18)26(7-3)8-4/h9-16H,5-8H2,1-4H3 |
कैस रजिस्टी संख्या | 1679-98-7 |
EINECS | 216-851-8 |
आणविक संरचना | |
घनत्व | 1.1g/cm3 |
उबलने का समय | 526.4°C at 760 mmHg |
अपवर्तक सूचकांक | 1.585 |
फ्लैश प्वाइंट | 272.2°C |
वाष्प का दबाव | 3.59E-11mmHg at 25°C |
सुरक्षा विवरण | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |