Chemindex > 3662-78-0 4-Methoxycarbonylphenyl isothiocyanate
SA ▼
3662-78-0 4-Methoxycarbonylphenyl isothiocyanate |
|
| اسم المنتج | 4-Methoxycarbonylphenyl isothiocyanate |
| الاسم بالانجليزية | 4-Methoxycarbonylphenyl isothiocyanate;Methyl 4-isothiocyanatobenzoate |
| الصيغة الجزيئية | C9H7NO2S |
| الوزن الجزيئي الغرامي | 193.2224 |
| InChI | InChI=1/C9H7NO2S/c1-12-9(11)7-2-4-8(5-3-7)10-6-13/h2-5H,1H3 |
| إستراتيجية المساعدة القطرية | 3662-78-0 |
| بنية جزيئية |  |
| كثافة | 1.16g/cm3 |
| نقطة الغليان | 314.3°C at 760 mmHg |
| معامل الإنكسار | 1.566 |
| نقطة الوميض | 143.9°C |
| ضغط البخار | 0.00047mmHg at 25°C |
| خطر المصطلحات | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
موردون للدولار 3662-78-0(0):
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd. 