Chemindex > 3662-78-0 4-Methoxycarbonylphenyl isothiocyanate
PL ▼
3662-78-0 4-Methoxycarbonylphenyl isothiocyanate |
|
| Nazwa produktu: | 4-Methoxycarbonylphenyl isothiocyanate |
| Angielska nazwa | 4-Methoxycarbonylphenyl isothiocyanate;Methyl 4-isothiocyanatobenzoate |
| MF | C9H7NO2S |
| Masie cząsteczkowej | 193.2224 |
| InChI | InChI=1/C9H7NO2S/c1-12-9(11)7-2-4-8(5-3-7)10-6-13/h2-5H,1H3 |
| Nr CAS | 3662-78-0 |
| Struktury molekularnej |  |
| Gęstość | 1.16g/cm3 |
| Temperatura wrzenia | 314.3°C at 760 mmHg |
| Współczynnik załamania | 1.566 |
| Temperatura zapłonu | 143.9°C |
| Ciśnienie pary | 0.00047mmHg at 25°C |
| Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jeśli planujesz zaopatrywać się w chemikalia z Chin, po prostu udaj się do centrum handlowego ChemNet, a my uzyskamy dla Ciebie najnowszą i konkurencyjną cenę od chińskich producentów.Odwiedź stronę
ChemNet Mall
Dostawcy za 3662-78-0(0):
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd. 