Chemindex > 3662-78-0 4-Methoxycarbonylphenyl isothiocyanate
NO ▼
3662-78-0 4-Methoxycarbonylphenyl isothiocyanate |
|
| produktnavn | 4-Methoxycarbonylphenyl isothiocyanate |
| Engelsk navn | 4-Methoxycarbonylphenyl isothiocyanate;Methyl 4-isothiocyanatobenzoate |
| Molekylær Formel | C9H7NO2S |
| Molekylvekt | 193.2224 |
| InChI | InChI=1/C9H7NO2S/c1-12-9(11)7-2-4-8(5-3-7)10-6-13/h2-5H,1H3 |
| CAS-nummer | 3662-78-0 |
| Molecular Structure |  |
| Tetthet | 1.16g/cm3 |
| Kokepunkt | 314.3°C at 760 mmHg |
| Brytningsindeks | 1.566 |
| Flammepunktet | 143.9°C |
| Damptrykk | 0.00047mmHg at 25°C |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 3662-78-0(0):
ChemNet is a registered trademark of Zhejiang NetSun Co., Ltd. 