ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22921-68-2 2-Bromo-5-methoxybenzoic acid |
|
Naam product | 2-Bromo-5-methoxybenzoic acid |
Engelse naam | 2-Bromo-5-methoxybenzoic acid;6-Bromo-m-anisic acid;2-bromo-5-methoxybenzoate |
MF | C8H6BrO3 |
Molecuulgewicht | 230.036 |
InChI | InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
CAS-nummer | 22921-68-2 |
EINECS | 245-329-2 |
Moleculaire Structuur | |
Smeltpunt | 158-159℃ |
Kookpunt | 337.8°C at 760 mmHg |
Vlampunt | 158.1°C |
Dampdruk | 4E-05mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |