ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22921-68-2 2-Bromo-5-methoxybenzoic acid |
|
उत्पाद का नाम | 2-Bromo-5-methoxybenzoic acid |
अंग्रेज | 2-Bromo-5-methoxybenzoic acid;6-Bromo-m-anisic acid;2-bromo-5-methoxybenzoate |
आणविक फार्मूला | C8H6BrO3 |
आण्विक वजन | 230.036 |
InChI | InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
कैस रजिस्टी संख्या | 22921-68-2 |
EINECS | 245-329-2 |
आणविक संरचना | |
गलनांक | 158-159℃ |
उबलने का समय | 337.8°C at 760 mmHg |
फ्लैश प्वाइंट | 158.1°C |
वाष्प का दबाव | 4E-05mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |