ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22921-68-2 2-Bromo-5-methoxybenzoic acid |
|
Produkt-Name | 2-Bromo-5-methoxybenzoic acid |
Englischer Name | 2-Bromo-5-methoxybenzoic acid;6-Bromo-m-anisic acid;2-bromo-5-methoxybenzoate |
Molekulare Formel | C8H6BrO3 |
Molecular Weight | 230.036 |
InChl | InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
CAS Registry Number | 22921-68-2 |
EINECS | 245-329-2 |
Molecular Structure | |
Schmelzpunkt | 158-159℃ |
Siedepunkt | 337.8°C at 760 mmHg |
Flammpunkt | 158.1°C |
Dampfdruck | 4E-05mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |