ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
96017-23-1 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one |
|
उत्पाद का नाम | 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one |
अंग्रेज | 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one;4-chloro-2-methyl-5-(1-methylhydrazino)pyridazin-3(2H)-one |
आणविक फार्मूला | C6H9ClN4O |
आण्विक वजन | 188.6149 |
InChI | InChI=1/C6H9ClN4O/c1-10(8)4-3-9-11(2)6(12)5(4)7/h3H,8H2,1-2H3 |
कैस रजिस्टी संख्या | 96017-23-1 |
आणविक संरचना | |
घनत्व | 1.46g/cm3 |
गलनांक | 131℃ |
उबलने का समय | 251.6°C at 760 mmHg |
अपवर्तक सूचकांक | 1.627 |
फ्लैश प्वाइंट | 106°C |
वाष्प का दबाव | 0.0203mmHg at 25°C |
खतरा प्रतीक | Xn##Harmful:; |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |