ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
96017-23-1 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one |
|
שם המוצר | 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one |
שם אנגלי | 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one;4-chloro-2-methyl-5-(1-methylhydrazino)pyridazin-3(2H)-one |
מולקולרית פורמולה | C6H9ClN4O |
משקל מולקולרי | 188.6149 |
InChl | InChI=1/C6H9ClN4O/c1-10(8)4-3-9-11(2)6(12)5(4)7/h3H,8H2,1-2H3 |
מספר CAS | 96017-23-1 |
מבנה מולקולרי | |
צפיפות | 1.46g/cm3 |
נקודת ההתוך | 131℃ |
נקודת רתיחה | 251.6°C at 760 mmHg |
משקל סגולי | 1.627 |
נקודת הבזק | 106°C |
לחץ אדים | 0.0203mmHg at 25°C |
Hazard סימנים | Xn##Harmful:; |
סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |