ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
96017-23-1 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one |
|
Ονομασία του προϊόντος | 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one |
Αγγλικό όνομα | 4-chloro-2-methyl-5-(1-methylhydrazino)-2,3-dihydropyridazin-3-one;4-chloro-2-methyl-5-(1-methylhydrazino)pyridazin-3(2H)-one |
MF | C6H9ClN4O |
Μοριακό βάρος | 188.6149 |
InChI | InChI=1/C6H9ClN4O/c1-10(8)4-3-9-11(2)6(12)5(4)7/h3H,8H2,1-2H3 |
CAS ΟΧΙ | 96017-23-1 |
Μοριακή δομή | |
Πυκνότητα | 1.46g/cm3 |
Σημείο τήξης | 131℃ |
Σημείο βρασμού | 251.6°C at 760 mmHg |
Δείκτης διάθλασης | 1.627 |
Σημείο ανάφλεξης | 106°C |
Πίεση ατμών | 0.0203mmHg at 25°C |
Σύμβολα επικινδυνότητας | Xn##Harmful:; |
Κινδύνου Κώδικες | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |