ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29418-67-5 2-Bromobenzhydrazide |
|
Ürün Adı | 2-Bromobenzhydrazide |
ingilizce adı | 2-Bromobenzhydrazide;2-Bromobenzohydrazide |
Moleküler Formülü | C7H7BrN2O |
Molekül Ağırlığı | 215.0473 |
InChI | InChI=1/C7H7BrN2O/c8-6-4-2-1-3-5(6)7(11)10-9/h1-4H,9H2,(H,10,11) |
CAS kayıt numarası | 29418-67-5 |
EINECS | 249-614-2 |
Moleküler Yapısı | |
Yoğunluk | 1.615g/cm3 |
Kaynama noktası | 367.2°C at 760 mmHg |
Kırılma indisi | 1.615 |
Alevlenme noktası | 175.9°C |
Buhar basıncı | 4.87E-06mmHg at 25°C |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |