ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29418-67-5 2-Bromobenzhydrazide |
|
Produkt-Name | 2-Bromobenzhydrazide |
Englischer Name | 2-Bromobenzhydrazide;2-Bromobenzohydrazide |
Molekulare Formel | C7H7BrN2O |
Molecular Weight | 215.0473 |
InChl | InChI=1/C7H7BrN2O/c8-6-4-2-1-3-5(6)7(11)10-9/h1-4H,9H2,(H,10,11) |
CAS Registry Number | 29418-67-5 |
EINECS | 249-614-2 |
Molecular Structure | |
Dichte | 1.615g/cm3 |
Siedepunkt | 367.2°C at 760 mmHg |
Brechungsindex | 1.615 |
Flammpunkt | 175.9°C |
Dampfdruck | 4.87E-06mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |