Chemindex > 23165-64-2
SA ▼
23165-64-2 2-chloro-4-nitrophenyl isothiocyanate |
|
| اسم المنتج | 2-chloro-4-nitrophenyl isothiocyanate |
| الاسم بالانجليزية | 2-chloro-4-nitrophenyl isothiocyanate;2-chloro-1-isothiocyanato-4-nitrobenzene |
| الصيغة الجزيئية | C7H3ClN2O2S |
| الوزن الجزيئي الغرامي | 214.6289 |
| InChI | InChI=1/C7H3ClN2O2S/c8-6-3-5(10(11)12)1-2-7(6)9-4-13/h1-3H |
| إستراتيجية المساعدة القطرية | 23165-64-2 |
| بنية جزيئية |  |
| كثافة | 1.48g/cm3 |
| درجة الإنصهار | 95-99℃ |
| نقطة الغليان | 354.1°C at 760 mmHg |
| معامل الإنكسار | 1.651 |
| نقطة الوميض | 167.9°C |
| ضغط البخار | 7.01E-05mmHg at 25°C |
| خطر المصطلحات | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
موردون للدولار 23165-64-2 (0):
يتم توفير خدمة قاعدة بيانات CAS الكي&# 