ChemIndex - Бесплатная база данных CAS по химическим веществамToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23165-64-2 2-chloro-4-nitrophenyl isothiocyanate |
|
Название продукта | 2-chloro-4-nitrophenyl isothiocyanate |
Английское название | 2-chloro-4-nitrophenyl isothiocyanate;2-chloro-1-isothiocyanato-4-nitrobenzene |
Молекулярная формула | C7H3ClN2O2S |
Молекулярный вес | 214.6289 |
InChI | InChI=1/C7H3ClN2O2S/c8-6-3-5(10(11)12)1-2-7(6)9-4-13/h1-3H |
Регистрационный номер CAS | 23165-64-2 |
Молекулярная структура | |
Плотность | 1.48g/cm3 |
Температура плавления | 95-99℃ |
Точка кипения | 354.1°C at 760 mmHg |
Показатель преломления | 1.651 |
Температура вспышки | 167.9°C |
Давление пара | 7.01E-05mmHg at 25°C |
Риск коды | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Характеристики безопасности | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |