ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84951-44-0 2-(1-Piperazinyl)-3-pyridinecarbonitrile |
|
Nazwa produktu: | 2-(1-Piperazinyl)-3-pyridinecarbonitrile |
Angielska nazwa | 2-(1-Piperazinyl)-3-pyridinecarbonitrile;1-(2-(3-Cyanopyridil))-piperazine;2-Piperazinonicotinonitrile;2-piperazin-1-ylpyridine-3-carbonitrile |
MF | C10H12N4 |
Masie cząsteczkowej | 188.2291 |
InChI | InChI=1/C10H12N4/c11-8-9-2-1-3-13-10(9)14-6-4-12-5-7-14/h1-3,12H,4-7H2 |
Nr CAS | 84951-44-0 |
Struktury molekularnej | |
Gęstość | 1.22g/cm3 |
Temperatura wrzenia | 388°C at 760 mmHg |
Współczynnik załamania | 1.605 |
Temperatura zapłonu | 188.4°C |
Ciśnienie pary | 3.17E-06mmHg at 25°C |
Symbole zagrożenia | C##Corrosive:; |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |