ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84951-44-0 2-(1-Piperazinyl)-3-pyridinecarbonitrile |
|
상품명칭 | 2-(1-Piperazinyl)-3-pyridinecarbonitrile |
영문 이름 | 2-(1-Piperazinyl)-3-pyridinecarbonitrile;1-(2-(3-Cyanopyridil))-piperazine;2-Piperazinonicotinonitrile;2-piperazin-1-ylpyridine-3-carbonitrile |
분자식 | C10H12N4 |
분자량 | 188.2291 |
InChI | InChI=1/C10H12N4/c11-8-9-2-1-3-13-10(9)14-6-4-12-5-7-14/h1-3,12H,4-7H2 |
cas번호 | 84951-44-0 |
분자 구조 | |
밀도 | 1.22g/cm3 |
비등점 | 388°C at 760 mmHg |
굴절 지수 | 1.605 |
인화점 | 188.4°C |
증기압 | 3.17E-06mmHg at 25°C |
위험성 표시 | C##Corrosive:; |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |