1195-52-4 3-(3-Thienyl)acrylic acid |
|
produktnavn | 3-(3-Thienyl)acrylic acid |
Engelsk navn | 3-(3-Thienyl)acrylic acid;Thiophene-3-acrylic acid;(2E)-3-thiophen-3-ylprop-2-enoate;(2Z)-3-(thiophen-3-yl)prop-2-enoic acid |
Molekylær Formel | C7H6O2S |
Molekylvekt | 154.1863 |
InChI | InChI=1/C7H6O2S/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1- |
CAS-nummer | 1195-52-4 |
EINECS | 214-800-4 |
Molecular Structure | |
Tetthet | 1.346g/cm3 |
Kokepunkt | 298.896°C at 760 mmHg |
Brytningsindeks | 1.656 |
Flammepunktet | 134.568°C |
Damptrykk | 0.001mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall