ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1195-52-4 3-(3-Thienyl)acrylic acid |
|
| termék neve | 3-(3-Thienyl)acrylic acid |
| Angol név | 3-(3-Thienyl)acrylic acid;Thiophene-3-acrylic acid;(2E)-3-thiophen-3-ylprop-2-enoate;(2Z)-3-(thiophen-3-yl)prop-2-enoic acid |
| MF | C7H6O2S |
| Molekulatömeg | 154.1863 |
| InChI | InChI=1/C7H6O2S/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1- |
| CAS-szám | 1195-52-4 |
| EINECS | 214-800-4 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.346g/cm3 |
| Forráspont | 298.896°C at 760 mmHg |
| Törésmutató | 1.656 |
| Gyulladáspont | 134.568°C |
| Gőznyomás | 0.001mmHg at 25°C |
| Kockázatot kódok | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |