1195-52-4 3-(3-Thienyl)acrylic acid |
|
Nama produk | 3-(3-Thienyl)acrylic acid |
Nama bahasa Inggris | 3-(3-Thienyl)acrylic acid;Thiophene-3-acrylic acid;(2E)-3-thiophen-3-ylprop-2-enoate;(2Z)-3-(thiophen-3-yl)prop-2-enoic acid |
MF | C7H6O2S |
Berat Molekul | 154.1863 |
InChI | InChI=1/C7H6O2S/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1- |
CAS NO | 1195-52-4 |
EINECS | 214-800-4 |
Struktur Molekul | |
Kepadatan | 1.346g/cm3 |
Titik didih | 298.896°C at 760 mmHg |
Indeks bias | 1.656 |
Titik nyala | 134.568°C |
Tekanan uap | 0.001mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |
- Jika Anda berencana untuk mendapatkan 3-(3-Thienyl)acrylic acid 1195-52-4 dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall