1585-17-7 2,4-Bis(chloromethyl)mesitylene |
|
Nama produk | 2,4-Bis(chloromethyl)mesitylene |
Nama Inggeris | 2,4-Bis(chloromethyl)mesitylene;2,4-Bis(chloromethyl)-1,3,5-trimethylbenzene~alpha(2),alpha(4)-Dichloro-1,2,3,4,5-pentamethylbenzene;2,4-Di(chloromethyl)-1,3,5-trimethylbenzene;2,4-bis(chloromethyl)-1,3,5-trimethylbenzene |
MF | C11H14Cl2 |
Berat Molekul | 217.1349 |
InChI | InChI=1/C11H14Cl2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4H,5-6H2,1-3H3 |
CAS NO | 1585-17-7 |
Struktur Molekul | |
Kepadatan | 1.121g/cm3 |
Titik lebur | 104-105℃ |
Titik didih | 311.7°C at 760 mmHg |
Indeks bias | 1.534 |
Titik nyala | 154.9°C |
Tekanan wap | 0.00102mmHg at 25°C |
Cinta bahaya | C##Corrosive:; |
Kod Risiko | R34##Causes burns.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall