1585-17-7 2,4-Bis(chloromethyl)mesitylene |
|
상품명칭 | 2,4-Bis(chloromethyl)mesitylene |
영문 이름 | 2,4-Bis(chloromethyl)mesitylene;2,4-Bis(chloromethyl)-1,3,5-trimethylbenzene~alpha(2),alpha(4)-Dichloro-1,2,3,4,5-pentamethylbenzene;2,4-Di(chloromethyl)-1,3,5-trimethylbenzene;2,4-bis(chloromethyl)-1,3,5-trimethylbenzene |
분자식 | C11H14Cl2 |
분자량 | 217.1349 |
InChI | InChI=1/C11H14Cl2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4H,5-6H2,1-3H3 |
cas번호 | 1585-17-7 |
분자 구조 | |
밀도 | 1.121g/cm3 |
녹는 점 | 104-105℃ |
비등점 | 311.7°C at 760 mmHg |
굴절 지수 | 1.534 |
인화점 | 154.9°C |
증기압 | 0.00102mmHg at 25°C |
위험성 표시 | C##Corrosive:; |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall