ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1585-17-7 2,4-Bis(chloromethyl)mesitylene |
|
| 상품명칭 | 2,4-Bis(chloromethyl)mesitylene |
| 영문 이름 | 2,4-Bis(chloromethyl)mesitylene;2,4-Bis(chloromethyl)-1,3,5-trimethylbenzene~alpha(2),alpha(4)-Dichloro-1,2,3,4,5-pentamethylbenzene;2,4-Di(chloromethyl)-1,3,5-trimethylbenzene;2,4-bis(chloromethyl)-1,3,5-trimethylbenzene |
| 분자식 | C11H14Cl2 |
| 분자량 | 217.1349 |
| InChI | InChI=1/C11H14Cl2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4H,5-6H2,1-3H3 |
| cas번호 | 1585-17-7 |
| 분자 구조 | ![]() |
| 밀도 | 1.121g/cm3 |
| 녹는 점 | 104-105℃ |
| 비등점 | 311.7°C at 760 mmHg |
| 굴절 지수 | 1.534 |
| 인화점 | 154.9°C |
| 증기압 | 0.00102mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |