1585-17-7 2,4-Bis(chloromethyl)mesitylene |
|
שם המוצר | 2,4-Bis(chloromethyl)mesitylene |
שם אנגלי | 2,4-Bis(chloromethyl)mesitylene;2,4-Bis(chloromethyl)-1,3,5-trimethylbenzene~alpha(2),alpha(4)-Dichloro-1,2,3,4,5-pentamethylbenzene;2,4-Di(chloromethyl)-1,3,5-trimethylbenzene;2,4-bis(chloromethyl)-1,3,5-trimethylbenzene |
מולקולרית פורמולה | C11H14Cl2 |
משקל מולקולרי | 217.1349 |
InChl | InChI=1/C11H14Cl2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4H,5-6H2,1-3H3 |
מספר CAS | 1585-17-7 |
מבנה מולקולרי | |
צפיפות | 1.121g/cm3 |
נקודת ההתוך | 104-105℃ |
נקודת רתיחה | 311.7°C at 760 mmHg |
משקל סגולי | 1.534 |
נקודת הבזק | 154.9°C |
לחץ אדים | 0.00102mmHg at 25°C |
Hazard סימנים | C##Corrosive:; |
סיכונים קודי | R34##Causes burns.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |
- אם אתם מתכננים להשיג span class="casspan">2,4-Bis(chloromethyl)mesitylene 1585-17-7 מסין, פשוט לכו לקניון ChemNet, אנו נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall