ChemIndex - A free chemical CAS databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3988-03-2 4,4'-dibromobenzophenone |
|
상품명칭 | 4,4'-dibromobenzophenone |
영문 이름 | 4,4'-dibromobenzophenone;Bis(p-bromophenyl) ketone;NSC 86518;p,p'-Dibromobenzophenone;Benzophenone, 4,4'-dibromo- (8CI);Methanone, bis(4-bromophenyl)- (9CI);bis(4-bromophenyl)methanone |
분자식 | C13H8Br2O |
분자량 | 340.01 |
InChI | InChI=1/C13H8Br2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
cas번호 | 3988-03-2 |
EC번호 | 223-632-0 |
분자 구조 | |
밀도 | 1.7g/cm3 |
녹는 점 | 171-174℃ |
비등점 | 395.6°C at 760 mmHg |
굴절 지수 | 1.633 |
인화점 | 121°C |
증기압 | 1.82E-06mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S22||S24/25:; |
MSDS |