ChemIndex - A free chemical CAS databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3988-03-2 4,4'-dibromobenzophenone |
|
نام محصول | 4,4'-dibromobenzophenone |
نام انگلیسی | 4,4'-dibromobenzophenone;Bis(p-bromophenyl) ketone;NSC 86518;p,p'-Dibromobenzophenone;Benzophenone, 4,4'-dibromo- (8CI);Methanone, bis(4-bromophenyl)- (9CI);bis(4-bromophenyl)methanone |
میدان مغناطیسی | C13H8Br2O |
وزن مولکولی | 340.01 |
InChI | InChI=1/C13H8Br2O/c14-11-5-1-9(2-6-11)13(16)10-3-7-12(15)8-4-10/h1-8H |
شماره سیایاس | 3988-03-2 |
تعداد کمیسیون اروپایی | 223-632-0 |
ساختار مولکولی | |
تراکم | 1.7g/cm3 |
نقطه ذوب | 171-174℃ |
نقطه غلیان | 395.6°C at 760 mmHg |
ضریب شکست | 1.633 |
نقطه اشتعال | 121°C |
فشار بخار | 1.82E-06mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S22||S24/25:; |
MSDS |