ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29840-73-1 2-Bromopyridine-4-carboxamide |
|
상품명칭 | 2-Bromopyridine-4-carboxamide |
영문 이름 | 2-Bromopyridine-4-carboxamide;2-Bromoisonicotinamide |
분자식 | C6H5BrN2O |
분자량 | 201.0207 |
InChI | InChI=1/C6H5BrN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
cas번호 | 29840-73-1 |
분자 구조 | |
밀도 | 1.71g/cm3 |
비등점 | 338.1°C at 760 mmHg |
굴절 지수 | 1.613 |
인화점 | 158.3°C |
증기압 | 0.0001mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |