ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29840-73-1 2-Bromopyridine-4-carboxamide |
|
Produkt-Name | 2-Bromopyridine-4-carboxamide |
Englischer Name | 2-Bromopyridine-4-carboxamide;2-Bromoisonicotinamide |
Molekulare Formel | C6H5BrN2O |
Molecular Weight | 201.0207 |
InChl | InChI=1/C6H5BrN2O/c7-5-3-4(6(8)10)1-2-9-5/h1-3H,(H2,8,10) |
CAS Registry Number | 29840-73-1 |
Molecular Structure | |
Dichte | 1.71g/cm3 |
Siedepunkt | 338.1°C at 760 mmHg |
Brechungsindex | 1.613 |
Flammpunkt | 158.3°C |
Dampfdruck | 0.0001mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |