ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
107367-98-6 2- (5- 메틸 -2- 페닐 -1,3- 옥사 졸 -4- 일) 아세트산 |
|
상품명칭 | 2- (5- 메틸 -2- 페닐 -1,3- 옥사 졸 -4- 일) 아세트산 |
별명 | (5- 메틸 -2- 페닐 -1,3- 옥사 졸 -4- 일) 아세트산; |
영문 이름 | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid;(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid |
분자식 | C12H11NO3 |
분자량 | 217.2206 |
InChI | InChI=1/C12H11NO3/c1-8-10(7-11(14)15)13-12(16-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,14,15) |
cas번호 | 107367-98-6 |
분자 구조 | |
밀도 | 1.245g/cm3 |
녹는 점 | 122℃ |
비등점 | 411.7°C at 760 mmHg |
굴절 지수 | 1.569 |
인화점 | 202.8°C |
증기압 | 1.63E-07mmHg at 25°C |
위험성 표시 | Xi##Irritant:; |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |