ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
107367-98-6 2-(5-Methyl-2-phenyl-1,3-oxazol-4-yl)essigsäure |
|
Produkt-Name | 2-(5-Methyl-2-phenyl-1,3-oxazol-4-yl)essigsäure |
Synonyme | (5-Methyl-2-phenyl-1,3-oxazol-4-yl)essigsäure; |
Englischer Name | 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid;(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid |
Molekulare Formel | C12H11NO3 |
Molecular Weight | 217.2206 |
InChl | InChI=1/C12H11NO3/c1-8-10(7-11(14)15)13-12(16-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,14,15) |
CAS Registry Number | 107367-98-6 |
Molecular Structure | |
Dichte | 1.245g/cm3 |
Schmelzpunkt | 122℃ |
Siedepunkt | 411.7°C at 760 mmHg |
Brechungsindex | 1.569 |
Flammpunkt | 202.8°C |
Dampfdruck | 1.63E-07mmHg at 25°C |
Gefahrensymbole | Xi##Irritant:; |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |