Chemindex > 49673-81-6
IT ▼
49673-81-6 L-lysine, compound with S-(carboxymethyl)-L-cysteine (1:1) |
|
| Nome del prodotto | L-lysine, compound with S-(carboxymethyl)-L-cysteine (1:1) |
| Nome inglese | L-lysine, compound with S-(carboxymethyl)-L-cysteine (1:1);S-(carboxymethyl)-L-cysteine-L-lysine (1:1);(2R)-2-(carboxymethylamino)-3-sulfanyl-propanoic acid; (2S)-2,6-diaminohexanoic acid;L-Lysine S-(Carboxymethyl)-L-Cysteine;L-Lysine-S-carboxymethyl-L-cysteine;L-Lysine S-Carboxymethyl-L-Cysteine |
| Formula molecolare | C11H23N3O6S |
| Peso Molecolare | 325.3818 |
| InChI | InChI=1/C6H14N2O2.C5H9NO4S/c7-4-2-1-3-5(8)6(9)10;7-4(8)1-6-3(2-11)5(9)10/h5H,1-4,7-8H2,(H,9,10);3,6,11H,1-2H2,(H,7,8)(H,9,10)/t5-;3-/m00/s1 |
| Numero CAS | 49673-81-6 |
| EINECS | 256-425-9 |
| Struttura molecolare |  |
| Punto di ebollizione | 600.2°C at 760 mmHg |
| Punto d'infiammabilità | 316.8°C |
| Pressione di vapore | 5.92E-16mmHg at 25°C |
| MSDS | |
- Se hai intenzione di procurarti prodotti chimici dalla Cina, vai al centro commerciale ChemNet, otterremo per te il prezzo più recente e competitivo dai produttori cinesi.Si prega di visitare
ChemNet Mall
Il servizio di database CAS chimico è fornito da ChemIndex.com 