ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
49673-81-6 L-lysine, compound with S-(carboxymethyl)-L-cysteine (1:1) |
|
שם המוצר | L-lysine, compound with S-(carboxymethyl)-L-cysteine (1:1) |
שם אנגלי | L-lysine, compound with S-(carboxymethyl)-L-cysteine (1:1);S-(carboxymethyl)-L-cysteine-L-lysine (1:1);(2R)-2-(carboxymethylamino)-3-sulfanyl-propanoic acid; (2S)-2,6-diaminohexanoic acid;L-Lysine S-(Carboxymethyl)-L-Cysteine;L-Lysine-S-carboxymethyl-L-cysteine;L-Lysine S-Carboxymethyl-L-Cysteine |
מולקולרית פורמולה | C11H23N3O6S |
משקל מולקולרי | 325.3818 |
InChl | InChI=1/C6H14N2O2.C5H9NO4S/c7-4-2-1-3-5(8)6(9)10;7-4(8)1-6-3(2-11)5(9)10/h5H,1-4,7-8H2,(H,9,10);3,6,11H,1-2H2,(H,7,8)(H,9,10)/t5-;3-/m00/s1 |
מספר CAS | 49673-81-6 |
EINECS | 256-425-9 |
מבנה מולקולרי | |
נקודת רתיחה | 600.2°C at 760 mmHg |
נקודת הבזק | 316.8°C |
לחץ אדים | 5.92E-16mmHg at 25°C |
MSDS |