ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
96784-54-2 3-Methyl-4-nitrobenzonitrile |
|
उत्पाद का नाम | 3-Methyl-4-nitrobenzonitrile |
अंग्रेज | 3-Methyl-4-nitrobenzonitrile;4-Nitro-m-tolunitrile; |
आणविक फार्मूला | C8H6N2O2 |
आण्विक वजन | 162.1454 |
InChI | InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
कैस रजिस्टी संख्या | 96784-54-2 |
आणविक संरचना | |
घनत्व | 1.26g/cm3 |
गलनांक | 82-83℃ |
उबलने का समय | 322.2°C at 760 mmHg |
अपवर्तक सूचकांक | 1.568 |
फ्लैश प्वाइंट | 148.6°C |
वाष्प का दबाव | 0.000284mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
सुरक्षा विवरण | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |