ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
96784-54-2 3-Methyl-4-nitrobenzonitrile |
|
termék neve | 3-Methyl-4-nitrobenzonitrile |
Angol név | 3-Methyl-4-nitrobenzonitrile;4-Nitro-m-tolunitrile; |
MF | C8H6N2O2 |
Molekulatömeg | 162.1454 |
InChI | InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
CAS-szám | 96784-54-2 |
Molekuláris szerkezete | |
Sűrűség | 1.26g/cm3 |
Olvadáspont | 82-83℃ |
Forráspont | 322.2°C at 760 mmHg |
Törésmutató | 1.568 |
Gyulladáspont | 148.6°C |
Gőznyomás | 0.000284mmHg at 25°C |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |