ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42779-10-2 Isobutylthioethanol |
|
Nama produk | Isobutylthioethanol |
Sinonim | ; 2- (Isobutylsulfanyl) etanol; 2-Hidroksietil isobutil sulfida; etanol, 2-[(2-metilpropil)thio]-; 2- [(2-metilpropil) sulfanil] etanol; |
Nama bahasa Inggris | Isobutylthioethanol;2-(Isobutylsulfanyl)ethanol;2-Hydroxyethyl isobutyl sulfide;ethanol, 2-[(2-methylpropyl)thio]-;2-[(2-methylpropyl)sulfanyl]ethanol |
MF | C6H14OS |
Berat Molekul | 134.2398 |
InChI | InChI=1/C6H14OS/c1-6(2)5-8-4-3-7/h6-7H,3-5H2,1-2H3 |
CAS NO | 42779-10-2 |
Struktur Molekul | |
Kepadatan | 0.962g/cm3 |
Titik didih | 211°C at 760 mmHg |
Indeks bias | 1.476 |
Titik nyala | 103.4°C |
Tekanan uap | 0.0422mmHg at 25°C |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Deskripsi | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |