Chemindex > 42779-10-2
NO ▼
42779-10-2 Isobutyltioetanol |
|
| produktnavn | Isobutyltioetanol |
| Synonymer | ; 2-(isobutylsulfanyl)etanol; 2-hydroksyetylisobutylsulfid; etanol, 2-[(2-metylpropyl)thio]-; 2-[(2-metylpropyl)sulfanyl]etanol; |
| Engelsk navn | Isobutylthioethanol;2-(Isobutylsulfanyl)ethanol;2-Hydroxyethyl isobutyl sulfide;ethanol, 2-[(2-methylpropyl)thio]-;2-[(2-methylpropyl)sulfanyl]ethanol |
| Molekylær Formel | C6H14OS |
| Molekylvekt | 134.2398 |
| InChI | InChI=1/C6H14OS/c1-6(2)5-8-4-3-7/h6-7H,3-5H2,1-2H3 |
| CAS-nummer | 42779-10-2 |
| Molecular Structure |  |
| Tetthet | 0.962g/cm3 |
| Kokepunkt | 211°C at 760 mmHg |
| Brytningsindeks | 1.476 |
| Flammepunktet | 103.4°C |
| Damptrykk | 0.0422mmHg at 25°C |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Sikkerhet Beskrivelse | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 42779-10-2 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 