ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
40784-88-1 Ethyl 4-ethoxyphenylacetate |
|
Nama produk | Ethyl 4-ethoxyphenylacetate |
Nama bahasa Inggris | Ethyl 4-ethoxyphenylacetate;4-Ethoxyphenylacetic acid ethyl ester |
MF | C12H16O3 |
Berat Molekul | 208.2536 |
InChI | InChI=1/C12H16O3/c1-3-14-11-7-5-10(6-8-11)9-12(13)15-4-2/h5-8H,3-4,9H2,1-2H3 |
CAS NO | 40784-88-1 |
Struktur Molekul | |
Kepadatan | 1.045g/cm3 |
Titik didih | 289.2°C at 760 mmHg |
Indeks bias | 1.495 |
Titik nyala | 116.8°C |
Tekanan uap | 0.00224mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |