ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
40784-88-1 Ethyl 4-ethoxyphenylacetate |
|
Produkt-Name | Ethyl 4-ethoxyphenylacetate |
Englischer Name | Ethyl 4-ethoxyphenylacetate;4-Ethoxyphenylacetic acid ethyl ester |
Molekulare Formel | C12H16O3 |
Molecular Weight | 208.2536 |
InChl | InChI=1/C12H16O3/c1-3-14-11-7-5-10(6-8-11)9-12(13)15-4-2/h5-8H,3-4,9H2,1-2H3 |
CAS Registry Number | 40784-88-1 |
Molecular Structure | |
Dichte | 1.045g/cm3 |
Siedepunkt | 289.2°C at 760 mmHg |
Brechungsindex | 1.495 |
Flammpunkt | 116.8°C |
Dampfdruck | 0.00224mmHg at 25°C |
Safety Beschreibung | S24/25##Avoid contact with skin and eyes.:; |
MSDS |