ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22019-49-4 2-bromo-1-(4-kloro-3-nitrofenil)etan-1-satu |
|
Nama produk | 2-bromo-1-(4-kloro-3-nitrofenil)etan-1-satu |
Sinonim | ; 4-Klorlo-3-nitrofenasilbromida; 2-bromo-1- (4-kloro-3-nitrofenil) etanon; |
Nama bahasa Inggris | 2-bromo-1-(4-chloro-3-nitrophenyl)ethan-1-one;4-Chloro-3-nitrophenacylbromide;2-bromo-1-(4-chloro-3-nitrophenyl)ethanone |
MF | C8H5BrClNO3 |
Berat Molekul | 278.4872 |
InChI | InChI=1/C8H5BrClNO3/c9-4-8(12)5-1-2-6(10)7(3-5)11(13)14/h1-3H,4H2 |
CAS NO | 22019-49-4 |
Struktur Molekul | |
Kepadatan | 1.763g/cm3 |
Titik lebur | 86℃ |
Titik didih | 336.1°C at 760 mmHg |
Indeks bias | 1.619 |
Titik nyala | 157.1°C |
Tekanan uap | 0.000115mmHg at 25°C |
Simbol bahaya | C##Corrosive:; |
Kode Risiko | R34##Causes burns.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |