ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
22019-49-4 2-bróm-1-(4-klór-3-nitrofenil)etán-1-on |
|
termék neve | 2-bróm-1-(4-klór-3-nitrofenil)etán-1-on |
Szinonimák | ; 4-klór-3-nitrofenacil-bromid; 2-bróm-1-(4-klór-3-nitrofenil)etanon; |
Angol név | 2-bromo-1-(4-chloro-3-nitrophenyl)ethan-1-one;4-Chloro-3-nitrophenacylbromide;2-bromo-1-(4-chloro-3-nitrophenyl)ethanone |
MF | C8H5BrClNO3 |
Molekulatömeg | 278.4872 |
InChI | InChI=1/C8H5BrClNO3/c9-4-8(12)5-1-2-6(10)7(3-5)11(13)14/h1-3H,4H2 |
CAS-szám | 22019-49-4 |
Molekuláris szerkezete | |
Sűrűség | 1.763g/cm3 |
Olvadáspont | 86℃ |
Forráspont | 336.1°C at 760 mmHg |
Törésmutató | 1.619 |
Gyulladáspont | 157.1°C |
Gőznyomás | 0.000115mmHg at 25°C |
Veszély szimbólumok | C##Corrosive:; |
Kockázatot kódok | R34##Causes burns.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |