ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98-81-7 alpha-bromostyrene |
|
Ürün Adı | alpha-bromostyrene |
ingilizce adı | alpha-bromostyrene;1-(1-Bromovinyl)benzene;(1-bromoethenyl)benzene |
Moleküler Formülü | C8H7Br |
Molekül Ağırlığı | 183.0452 |
InChI | InChI=1/C8H7Br/c1-7(9)8-5-3-2-4-6-8/h2-6H,1H2 |
CAS kayıt numarası | 98-81-7 |
EINECS | 202-702-4 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.387g/cm3 |
Ergime noktası | -44℃ |
Kaynama noktası | 212.6°C at 760 mmHg |
Kırılma indisi | 1.574 |
Alevlenme noktası | 98.3°C |
Buhar basıncı | 0.249mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |