ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
96-20-8 (±)-2-Amino-1-butanol |
|
Ürün Adı | (±)-2-Amino-1-butanol |
ingilizce adı | (±)-2-Amino-1-butanol;(-)-2-Aminobutanol;.+/-.-2-Amino-1-butanol;1-butanol, 2-amino-;2-Aminobutan-1-ol;2-Amino-1-butanol;2-aminobutan-2-ol;2-Amino-1-butanol |
Moleküler Formülü | C4H12NO |
Molekül Ağırlığı | 90.1436 |
InChI | InChI=1/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/p+1/t4-/m1/s1 |
CAS kayıt numarası | 96-20-8 |
EINECS | 202-488-2 |
Moleküler Yapısı | ![]() |
Ergime noktası | -2℃ |
Kaynama noktası | 177.2°C at 760 mmHg |
Alevlenme noktası | 82.2°C |
Buhar basıncı | 0.319mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |