ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,3-heptanedione |
|
Ürün Adı | 2,3-heptanedione |
ingilizce adı | 2,3-heptanedione;2,3-Heptanedione;Acetyl pentanoyl;Acetyl valeryl;FEMA No. 2543;NSC 31668;UNII-DK55DDE86P;Valerylacetyl;heptane-2,3-dione |
Moleküler Formülü | C7H12O2 |
Molekül Ağırlığı | 128.169 |
InChI | InChI=1/C7H12O2/c1-3-4-5-7(9)6(2)8/h3-5H2,1-2H3 |
CAS kayıt numarası | 96-04-8 |
EINECS | 202-472-5 |
Moleküler Yapısı | |
Yoğunluk | 0.926g/cm3 |
Kaynama noktası | 149.7°C at 760 mmHg |
Kırılma indisi | 1.413 |
Alevlenme noktası | 45°C |
Buhar basıncı | 3.98mmHg at 25°C |
Risk Kodları | R10##Flammable.:; |
Güvenlik Açıklaması | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |