ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
95727-77-8 2,6-Diflorobütyrofenon |
|
Ürün Adı | 2,6-Diflorobütyrofenon |
Eş anlamlı | 1- (2,6-diflorofenil) bütan-1-on; |
ingilizce adı | 2,6-Difluorobutyrophenone;1-(2,6-difluorophenyl)butan-1-one |
Moleküler Formülü | C10H10F2O |
Molekül Ağırlığı | 184.1826 |
InChI | InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
CAS kayıt numarası | 95727-77-8 |
Moleküler Yapısı | |
Yoğunluk | 1.134g/cm3 |
Kaynama noktası | 219.6°C at 760 mmHg |
Kırılma indisi | 1.472 |
Alevlenme noktası | 82.6°C |
Buhar basıncı | 0.118mmHg at 25°C |
Risk Kodları | R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |