ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-Dimethylbenzothiazole |
|
Ürün Adı | 2,5-Dimethylbenzothiazole |
ingilizce adı | 2,5-Dimethylbenzothiazole;Benzothiazole, 2,5-dimethyl-;2,5-Dimethylbenzthiazol;2,5-Dimethylbenzthiazol [Czech];4-27-00-01101 (Beilstein Handbook Reference);BRN 0116455;2,5-dimethyl-1,3-benzothiazole |
Moleküler Formülü | C9H9NS |
Molekül Ağırlığı | 163.2395 |
InChI | InChI=1/C9H9NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
CAS kayıt numarası | 95-26-1 |
EINECS | 202-404-4 |
Moleküler Yapısı | |
Yoğunluk | 1.176g/cm3 |
Ergime noktası | 36-40℃ |
Kaynama noktası | 259.4°C at 760 mmHg |
Kırılma indisi | 1.643 |
Alevlenme noktası | 112.7°C |
Buhar basıncı | 0.021mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Güvenlik Açıklaması | S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |