ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
isopentyl benzoate |
|
Ürün Adı | isopentyl benzoate |
ingilizce adı | isopentyl benzoate;Benzoic acid isoamyl ester;3-methyl-1-butanol benzoate;benzoic acid isopentyl ester;Isoamyl Benzoate;3-methylbutyl benzoate |
Moleküler Formülü | C12H16O2 |
Molekül Ağırlığı | 192.2542 |
InChI | InChI=1/C12H16O2/c1-10(2)8-9-14-12(13)11-6-4-3-5-7-11/h3-7,10H,8-9H2,1-2H3 |
CAS kayıt numarası | 94-46-2 |
EINECS | 202-334-4 |
Moleküler Yapısı | |
Yoğunluk | 0.992g/cm3 |
Kaynama noktası | 260°C at 760 mmHg |
Kırılma indisi | 1.495 |
Alevlenme noktası | 109.4°C |
Buhar basıncı | 0.0125mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |