ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-Aminohippuric acid, sodium salt monohydrate |
|
Ürün Adı | 4-Aminohippuric acid, sodium salt monohydrate |
ingilizce adı | 4-Aminohippuric acid, sodium salt monohydrate;4-Aminohippuric acid sodium salt hydrate;Sodium 4-aminohippurate hydrate;Aminohippurate Sodium;sodium [(4-aminobenzoyl)amino]acetate |
Moleküler Formülü | C9H9N2NaO3 |
Molekül Ağırlığı | 216.1691 |
InChI | InChI=1/C9H10N2O3.Na/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13;/h1-4H,5,10H2,(H,11,14)(H,12,13);/q;+1/p-1 |
CAS kayıt numarası | 94-16-6 |
EINECS | 202-309-8 |
Moleküler Yapısı | |
Ergime noktası | 123-125℃ |
Kaynama noktası | 517.2°C at 760 mmHg |
Alevlenme noktası | 266.6°C |
Buhar basıncı | 1.6E-11mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |