ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
927-67-3 n-Propylthiourea |
|
Ürün Adı | n-Propylthiourea |
ingilizce adı | n-Propylthiourea;Propyl-2-thiourea;Propylthiourea;Thiourea, propyl-;1-propylthiourea |
Moleküler Formülü | C4H10N2S |
Molekül Ağırlığı | 118.2006 |
InChI | InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
CAS kayıt numarası | 927-67-3 |
EINECS | 213-158-2 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.054g/cm3 |
Kaynama noktası | 182.1°C at 760 mmHg |
Kırılma indisi | 1.537 |
Alevlenme noktası | 63.9°C |
Buhar basıncı | 0.825mmHg at 25°C |
Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Güvenlik Açıklaması | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |