ChemIndex - Ücretsiz bir kimyasal CAS veritabanıChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
İzopülegol |
|
Ürün Adı | İzopülegol |
Eş anlamlı | ; 1-Metil-4-izopropenilsikloheksan-3-ol; p-menth-8-en-3-ol; (1R, 2S, 5R) -5-metil-2- (prop-1-en-2-il) sikloheksanol; |
ingilizce adı | Isopulegol;1-Methyl-4-isopropenylcyclohexan-3-ol;p-menth-8-en-3-ol;(1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
Moleküler Formülü | C10H18O |
Molekül Ağırlığı | 154.2493 |
InChI | InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
CAS kayıt numarası | 89-79-2 |
EINECS | 201-940-6 |
Moleküler Yapısı | |
Yoğunluk | 0.912g/cm3 |
Kaynama noktası | 197°C at 760 mmHg |
Kırılma indisi | 1.472 |
Alevlenme noktası | 78.3°C |
Buhar basıncı | 0.0993mmHg at 25°C |
Tehlike Sembolleri | Xn##Harmful:; |
Risk Kodları | R21/22##Harmful in contact with skin and if swallowed.:; |
MSDS |